C23H22N4O3 — CID 139444684
ethyl (E)-3-[2-[(3-cyanobenzoyl)amino]-1-propylbenzimidazol-5-yl]prop-2-enoate (PubChem CID 139444684) has the molecular formula C23H22N4O3 and a molecular weight of 402.45 g/mol. Its IUPAC name is ethyl (E)-3-[2-[(3-cyanobenzoyl)amino]-1-propylbenzimidazol-5-yl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[2-[(3-cyanobenzoyl)amino]-1-propylbenzimidazol-5-yl]prop-2-enoate |
|---|---|
| PubChem CID | 139444684 |
| Molecular Formula | C23H22N4O3 |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | ethyl (E)-3-[2-[(3-cyanobenzoyl)amino]-1-propylbenzimidazol-5-yl]prop-2-enoate |
| SMILES | CCCn1c(NC(=O)c2cccc(C#N)c2)nc2cc(/C=C/C(=O)OCC)ccc21 |
| InChI | InChI=1S/C23H22N4O3/c1-3-12-27-20-10-8-16(9-11-21(28)30-4-2)14-19(20)25-23(27)26-22(29)18-7-5-6-17(13-18)15-24/h5-11,13-14H,3-4,12H2,1-2H3,(H,25,26,29)/b11-9+ |
| InChIKey | ABODTGYHFUIJJX-PKNBQFBNSA-N |
| XLogP | 4.15 |
| TPSA | 97.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|