C25H27N5O3 — CID 67045265
3-cyano-N-[1-(3-methoxypropyl)-6-(piperidine-4-carbonyl)benzimidazol-2-yl]benzamide (PubChem CID 67045265) has the molecular formula C25H27N5O3 and a molecular weight of 445.52 g/mol. Its IUPAC name is 3-cyano-N-[1-(3-methoxypropyl)-6-(piperidine-4-carbonyl)benzimidazol-2-yl]benzamide.
| Compound Name | 3-cyano-N-[1-(3-methoxypropyl)-6-(piperidine-4-carbonyl)benzimidazol-2-yl]benzamide |
|---|---|
| PubChem CID | 67045265 |
| Molecular Formula | C25H27N5O3 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.21 |
| IUPAC Name | 3-cyano-N-[1-(3-methoxypropyl)-6-(piperidine-4-carbonyl)benzimidazol-2-yl]benzamide |
| SMILES | COCCCn1c(NC(=O)c2cccc(C#N)c2)nc2ccc(C(=O)C3CCNCC3)cc21 |
| InChI | InChI=1S/C25H27N5O3/c1-33-13-3-12-30-22-15-19(23(31)18-8-10-27-11-9-18)6-7-21(22)28-25(30)29-24(32)20-5-2-4-17(14-20)16-26/h2,4-7,14-15,18,27H,3,8-13H2,1H3,(H,28,29,32) |
| InChIKey | NBQGYVSASXYGCM-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 109.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|