C25H29N7O3 — CID 69105372
3-cyano-N-[6-[3-(dimethylamino)pyrrolidine-1-carbonyl]-3-(3-methoxypropyl)imidazo[4,5-b]pyridin-2-yl]benzamide (PubChem CID 69105372) has the molecular formula C25H29N7O3 and a molecular weight of 475.55 g/mol. Its IUPAC name is 3-cyano-N-[6-[3-(dimethylamino)pyrrolidine-1-carbonyl]-3-(3-methoxypropyl)imidazo[4,5-b]pyridin-2-yl]benzamide.
| Compound Name | 3-cyano-N-[6-[3-(dimethylamino)pyrrolidine-1-carbonyl]-3-(3-methoxypropyl)imidazo[4,5-b]pyridin-2-yl]benzamide |
|---|---|
| PubChem CID | 69105372 |
| Molecular Formula | C25H29N7O3 |
| Molecular Weight | 475.55 g/mol |
| Exact Mass | 475.23 |
| IUPAC Name | 3-cyano-N-[6-[3-(dimethylamino)pyrrolidine-1-carbonyl]-3-(3-methoxypropyl)imidazo[4,5-b]pyridin-2-yl]benzamide |
| SMILES | COCCCn1c(NC(=O)c2cccc(C#N)c2)nc2cc(C(=O)N3CCC(N(C)C)C3)cnc21 |
| InChI | InChI=1S/C25H29N7O3/c1-30(2)20-8-10-31(16-20)24(34)19-13-21-22(27-15-19)32(9-5-11-35-3)25(28-21)29-23(33)18-7-4-6-17(12-18)14-26/h4,6-7,12-13,15,20H,5,8-11,16H2,1-3H3,(H,28,29,33) |
| InChIKey | MVQBQDZAGTXOLB-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 116.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.55 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|