C25H32N6O3 — CID 70319093
3-amino-N-[6-(3,5-dimethylpiperidine-1-carbonyl)-3-(3-methoxypropyl)imidazo[4,5-b]pyridin-2-yl]benzamide (PubChem CID 70319093) has the molecular formula C25H32N6O3 and a molecular weight of 464.57 g/mol. Its IUPAC name is 3-amino-N-[6-(3,5-dimethylpiperidine-1-carbonyl)-3-(3-methoxypropyl)imidazo[4,5-b]pyridin-2-yl]benzamide.
| Compound Name | 3-amino-N-[6-(3,5-dimethylpiperidine-1-carbonyl)-3-(3-methoxypropyl)imidazo[4,5-b]pyridin-2-yl]benzamide |
|---|---|
| PubChem CID | 70319093 |
| Molecular Formula | C25H32N6O3 |
| Molecular Weight | 464.57 g/mol |
| Exact Mass | 464.25 |
| IUPAC Name | 3-amino-N-[6-(3,5-dimethylpiperidine-1-carbonyl)-3-(3-methoxypropyl)imidazo[4,5-b]pyridin-2-yl]benzamide |
| SMILES | COCCCn1c(NC(=O)c2cccc(N)c2)nc2cc(C(=O)N3CC(C)CC(C)C3)cnc21 |
| InChI | InChI=1S/C25H32N6O3/c1-16-10-17(2)15-30(14-16)24(33)19-12-21-22(27-13-19)31(8-5-9-34-3)25(28-21)29-23(32)18-6-4-7-20(26)11-18/h4,6-7,11-13,16-17H,5,8-10,14-15,26H2,1-3H3,(H,28,29,32) |
| InChIKey | HPSYPVFRYDEWHA-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 115.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.57 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|