C23H30N6O3 — CID 70317721
2-[(3-aminobenzoyl)amino]-N-ethyl-3-(3-methoxypropyl)-N-propan-2-ylimidazo[4,5-b]pyridine-6-carboxamide (PubChem CID 70317721) has the molecular formula C23H30N6O3 and a molecular weight of 438.53 g/mol. Its IUPAC name is 2-[(3-aminobenzoyl)amino]-N-ethyl-3-(3-methoxypropyl)-N-propan-2-ylimidazo[4,5-b]pyridine-6-carboxamide.
| Compound Name | 2-[(3-aminobenzoyl)amino]-N-ethyl-3-(3-methoxypropyl)-N-propan-2-ylimidazo[4,5-b]pyridine-6-carboxamide |
|---|---|
| PubChem CID | 70317721 |
| Molecular Formula | C23H30N6O3 |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 438.24 |
| IUPAC Name | 2-[(3-aminobenzoyl)amino]-N-ethyl-3-(3-methoxypropyl)-N-propan-2-ylimidazo[4,5-b]pyridine-6-carboxamide |
| SMILES | CCN(C(=O)c1cnc2c(c1)nc(NC(=O)c1cccc(N)c1)n2CCCOC)C(C)C |
| InChI | InChI=1S/C23H30N6O3/c1-5-28(15(2)3)22(31)17-13-19-20(25-14-17)29(10-7-11-32-4)23(26-19)27-21(30)16-8-6-9-18(24)12-16/h6,8-9,12-15H,5,7,10-11,24H2,1-4H3,(H,26,27,30) |
| InChIKey | HXRDOMFCYWCXRF-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 115.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|