C26H25N7O3 — CID 59742928
2-[(3-cyanobenzoyl)amino]-3-(3-methoxypropyl)-N-methyl-N-(pyridin-3-ylmethyl)imidazo[4,5-b]pyridine-6-carboxamide (PubChem CID 59742928) has the molecular formula C26H25N7O3 and a molecular weight of 483.53 g/mol. Its IUPAC name is 2-[(3-cyanobenzoyl)amino]-3-(3-methoxypropyl)-N-methyl-N-(pyridin-3-ylmethyl)imidazo[4,5-b]pyridine-6-carboxamide.
| Compound Name | 2-[(3-cyanobenzoyl)amino]-3-(3-methoxypropyl)-N-methyl-N-(pyridin-3-ylmethyl)imidazo[4,5-b]pyridine-6-carboxamide |
|---|---|
| PubChem CID | 59742928 |
| Molecular Formula | C26H25N7O3 |
| Molecular Weight | 483.53 g/mol |
| Exact Mass | 483.20 |
| IUPAC Name | 2-[(3-cyanobenzoyl)amino]-3-(3-methoxypropyl)-N-methyl-N-(pyridin-3-ylmethyl)imidazo[4,5-b]pyridine-6-carboxamide |
| SMILES | COCCCn1c(NC(=O)c2cccc(C#N)c2)nc2cc(C(=O)N(C)Cc3cccnc3)cnc21 |
| InChI | InChI=1S/C26H25N7O3/c1-32(17-19-7-4-9-28-15-19)25(35)21-13-22-23(29-16-21)33(10-5-11-36-2)26(30-22)31-24(34)20-8-3-6-18(12-20)14-27/h3-4,6-9,12-13,15-16H,5,10-11,17H2,1-2H3,(H,30,31,34) |
| InChIKey | VIVMTRDBJSRGLR-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 126.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.53 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|