C24H30N6O4 — CID 70318198
3-amino-N-[6-[(3S)-3-methoxypiperidine-1-carbonyl]-3-(3-methoxypropyl)imidazo[4,5-b]pyridin-2-yl]benzamide (PubChem CID 70318198) has the molecular formula C24H30N6O4 and a molecular weight of 466.54 g/mol. Its IUPAC name is 3-amino-N-[6-[(3S)-3-methoxypiperidine-1-carbonyl]-3-(3-methoxypropyl)imidazo[4,5-b]pyridin-2-yl]benzamide.
| Compound Name | 3-amino-N-[6-[(3S)-3-methoxypiperidine-1-carbonyl]-3-(3-methoxypropyl)imidazo[4,5-b]pyridin-2-yl]benzamide |
|---|---|
| PubChem CID | 70318198 |
| Molecular Formula | C24H30N6O4 |
| Molecular Weight | 466.54 g/mol |
| Exact Mass | 466.23 |
| IUPAC Name | 3-amino-N-[6-[(3S)-3-methoxypiperidine-1-carbonyl]-3-(3-methoxypropyl)imidazo[4,5-b]pyridin-2-yl]benzamide |
| SMILES | COCCCn1c(NC(=O)c2cccc(N)c2)nc2cc(C(=O)N3CCC[C@H](OC)C3)cnc21 |
| InChI | InChI=1S/C24H30N6O4/c1-33-11-5-10-30-21-20(27-24(30)28-22(31)16-6-3-7-18(25)12-16)13-17(14-26-21)23(32)29-9-4-8-19(15-29)34-2/h3,6-7,12-14,19H,4-5,8-11,15,25H2,1-2H3,(H,27,28,31)/t19-/m0/s1 |
| InChIKey | FNADYJAIWOZCHU-IBGZPJMESA-N |
| XLogP | 2.55 |
| TPSA | 124.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.54 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|