C23H28N6O4 — CID 70318590
3-amino-N-[6-(3-hydroxypiperidine-1-carbonyl)-3-(3-methoxypropyl)imidazo[4,5-b]pyridin-2-yl]benzamide (PubChem CID 70318590) has the molecular formula C23H28N6O4 and a molecular weight of 452.52 g/mol. Its IUPAC name is 3-amino-N-[6-(3-hydroxypiperidine-1-carbonyl)-3-(3-methoxypropyl)imidazo[4,5-b]pyridin-2-yl]benzamide.
| Compound Name | 3-amino-N-[6-(3-hydroxypiperidine-1-carbonyl)-3-(3-methoxypropyl)imidazo[4,5-b]pyridin-2-yl]benzamide |
|---|---|
| PubChem CID | 70318590 |
| Molecular Formula | C23H28N6O4 |
| Molecular Weight | 452.52 g/mol |
| Exact Mass | 452.22 |
| IUPAC Name | 3-amino-N-[6-(3-hydroxypiperidine-1-carbonyl)-3-(3-methoxypropyl)imidazo[4,5-b]pyridin-2-yl]benzamide |
| SMILES | COCCCn1c(NC(=O)c2cccc(N)c2)nc2cc(C(=O)N3CCCC(O)C3)cnc21 |
| InChI | InChI=1S/C23H28N6O4/c1-33-10-4-9-29-20-19(26-23(29)27-21(31)15-5-2-6-17(24)11-15)12-16(13-25-20)22(32)28-8-3-7-18(30)14-28/h2,5-6,11-13,18,30H,3-4,7-10,14,24H2,1H3,(H,26,27,31) |
| InChIKey | ZHXYIQNJTQXQQF-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 135.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.52 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|