C26H31ClN4O3 — CID 58742504
3-chloro-N-[5-[(2-cyclopentylacetyl)-methylamino]-1-(3-methoxypropyl)benzimidazol-2-yl]benzamide (PubChem CID 58742504) has the molecular formula C26H31ClN4O3 and a molecular weight of 483.01 g/mol. Its IUPAC name is 3-chloro-N-[5-[(2-cyclopentylacetyl)-methylamino]-1-(3-methoxypropyl)benzimidazol-2-yl]benzamide.
| Compound Name | 3-chloro-N-[5-[(2-cyclopentylacetyl)-methylamino]-1-(3-methoxypropyl)benzimidazol-2-yl]benzamide |
|---|---|
| PubChem CID | 58742504 |
| Molecular Formula | C26H31ClN4O3 |
| Molecular Weight | 483.01 g/mol |
| Exact Mass | 482.21 |
| IUPAC Name | 3-chloro-N-[5-[(2-cyclopentylacetyl)-methylamino]-1-(3-methoxypropyl)benzimidazol-2-yl]benzamide |
| SMILES | COCCCn1c(NC(=O)c2cccc(Cl)c2)nc2cc(N(C)C(=O)CC3CCCC3)ccc21 |
| InChI | InChI=1S/C26H31ClN4O3/c1-30(24(32)15-18-7-3-4-8-18)21-11-12-23-22(17-21)28-26(31(23)13-6-14-34-2)29-25(33)19-9-5-10-20(27)16-19/h5,9-12,16-18H,3-4,6-8,13-15H2,1-2H3,(H,28,29,33) |
| InChIKey | ABZCFESTCUZHEM-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.01 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|