C26H27F4N7O3 — CID 58742731
4-azido-N-[5-[cyclohexanecarbonyl(methyl)amino]-1-(3-methoxypropyl)benzimidazol-2-yl]-2,3,5,6-tetrafluorobenzamide (PubChem CID 58742731) has the molecular formula C26H27F4N7O3 and a molecular weight of 561.54 g/mol. Its IUPAC name is 4-azido-N-[5-[cyclohexanecarbonyl(methyl)amino]-1-(3-methoxypropyl)benzimidazol-2-yl]-2,3,5,6-tetrafluorobenzamide.
| Compound Name | 4-azido-N-[5-[cyclohexanecarbonyl(methyl)amino]-1-(3-methoxypropyl)benzimidazol-2-yl]-2,3,5,6-tetrafluorobenzamide |
|---|---|
| PubChem CID | 58742731 |
| Molecular Formula | C26H27F4N7O3 |
| Molecular Weight | 561.54 g/mol |
| Exact Mass | 561.21 |
| IUPAC Name | 4-azido-N-[5-[cyclohexanecarbonyl(methyl)amino]-1-(3-methoxypropyl)benzimidazol-2-yl]-2,3,5,6-tetrafluorobenzamide |
| SMILES | COCCCn1c(NC(=O)c2c(F)c(F)c(N=[N+]=[N-])c(F)c2F)nc2cc(N(C)C(=O)C3CCCCC3)ccc21 |
| InChI | InChI=1S/C26H27F4N7O3/c1-36(25(39)14-7-4-3-5-8-14)15-9-10-17-16(13-15)32-26(37(17)11-6-12-40-2)33-24(38)18-19(27)21(29)23(34-35-31)22(30)20(18)28/h9-10,13-14H,3-8,11-12H2,1-2H3,(H,32,33,38) |
| InChIKey | VOFJYANQRVIUEU-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 125.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.54 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|