C15H27NO6 — CID 139446928
3-[2-[bis[2-(3-oxopropoxy)ethyl]amino]ethoxy]propanal (PubChem CID 139446928) has the molecular formula C15H27NO6 and a molecular weight of 317.38 g/mol. Its IUPAC name is 3-[2-[bis[2-(3-oxopropoxy)ethyl]amino]ethoxy]propanal.
| Compound Name | 3-[2-[bis[2-(3-oxopropoxy)ethyl]amino]ethoxy]propanal |
|---|---|
| PubChem CID | 139446928 |
| Molecular Formula | C15H27NO6 |
| Molecular Weight | 317.38 g/mol |
| Exact Mass | 317.18 |
| IUPAC Name | 3-[2-[bis[2-(3-oxopropoxy)ethyl]amino]ethoxy]propanal |
| SMILES | O=CCCOCCN(CCOCCC=O)CCOCCC=O |
| InChI | InChI=1S/C15H27NO6/c17-7-1-10-20-13-4-16(5-14-21-11-2-8-18)6-15-22-12-3-9-19/h7-9H,1-6,10-15H2 |
| InChIKey | IFLUXXVNSIEVHT-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.38 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|