C13H17N3O2 — CID 139447792
(1S,2R,4R)-4-(2-aminobenzimidazol-1-yl)cyclohexane-1,2-diol (PubChem CID 139447792) has the molecular formula C13H17N3O2 and a molecular weight of 247.30 g/mol. Its IUPAC name is (1S,2R,4R)-4-(2-aminobenzimidazol-1-yl)cyclohexane-1,2-diol.
| Compound Name | (1S,2R,4R)-4-(2-aminobenzimidazol-1-yl)cyclohexane-1,2-diol |
|---|---|
| PubChem CID | 139447792 |
| Molecular Formula | C13H17N3O2 |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.13 |
| IUPAC Name | (1S,2R,4R)-4-(2-aminobenzimidazol-1-yl)cyclohexane-1,2-diol |
| SMILES | Nc1nc2ccccc2n1[C@@H]1CC[C@H](O)[C@H](O)C1 |
| InChI | InChI=1S/C13H17N3O2/c14-13-15-9-3-1-2-4-10(9)16(13)8-5-6-11(17)12(18)7-8/h1-4,8,11-12,17-18H,5-7H2,(H2,14,15)/t8-,11+,12-/m1/s1 |
| InChIKey | PHHCERWAWSTTEW-JFUSQASVSA-N |
| XLogP | 1.07 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |