C13H17N3O — CID 139447970
cis-(1S,3R)-3-(2-aminobenzimidazol-1-yl)cyclohexan-1-ol (PubChem CID 139447970) has the molecular formula C13H17N3O and a molecular weight of 231.30 g/mol. Its IUPAC name is cis-(1S,3R)-3-(2-aminobenzimidazol-1-yl)cyclohexan-1-ol.
| Compound Name | cis-(1S,3R)-3-(2-aminobenzimidazol-1-yl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 139447970 |
| Molecular Formula | C13H17N3O |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.14 |
| IUPAC Name | cis-(1S,3R)-3-(2-aminobenzimidazol-1-yl)cyclohexan-1-ol |
| SMILES | Nc1nc2ccccc2n1[C@@H]1CCC[C@H](O)C1 |
| InChI | InChI=1S/C13H17N3O/c14-13-15-11-6-1-2-7-12(11)16(13)9-4-3-5-10(17)8-9/h1-2,6-7,9-10,17H,3-5,8H2,(H2,14,15)/t9-,10+/m1/s1 |
| InChIKey | GSTYYSXXJWHHAX-ZJUUUORDSA-N |
| XLogP | 2.09 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |