C14H20O — CID 139448709
1-methyl-2-(2-methylcyclohexyl)oxybenzene (PubChem CID 139448709) has the molecular formula C14H20O and a molecular weight of 204.31 g/mol. Its IUPAC name is 1-methyl-2-(2-methylcyclohexyl)oxybenzene.
| Compound Name | 1-methyl-2-(2-methylcyclohexyl)oxybenzene |
|---|---|
| PubChem CID | 139448709 |
| Molecular Formula | C14H20O |
| Molecular Weight | 204.31 g/mol |
| Exact Mass | 204.15 |
| IUPAC Name | 1-methyl-2-(2-methylcyclohexyl)oxybenzene |
| SMILES | Cc1ccccc1OC1CCCCC1C |
| InChI | InChI=1S/C14H20O/c1-11-7-3-5-9-13(11)15-14-10-6-4-8-12(14)2/h3,5,7,9,12,14H,4,6,8,10H2,1-2H3 |
| InChIKey | CJKAQMDSLHAICD-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.31 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |