C21H32N2O — CID 129413171
(4aS,8aR)-4-[(1R,2R)-2-(2-methylphenoxy)cyclohexyl]-2,3,4a,5,6,7,8,8a-octahydro-1H-quinoxaline (PubChem CID 129413171) has the molecular formula C21H32N2O and a molecular weight of 328.50 g/mol. Its IUPAC name is (4aS,8aR)-4-[(1R,2R)-2-(2-methylphenoxy)cyclohexyl]-2,3,4a,5,6,7,8,8a-octahydro-1H-quinoxaline.
| Compound Name | (4aS,8aR)-4-[(1R,2R)-2-(2-methylphenoxy)cyclohexyl]-2,3,4a,5,6,7,8,8a-octahydro-1H-quinoxaline |
|---|---|
| PubChem CID | 129413171 |
| Molecular Formula | C21H32N2O |
| Molecular Weight | 328.50 g/mol |
| Exact Mass | 328.25 |
| IUPAC Name | (4aS,8aR)-4-[(1R,2R)-2-(2-methylphenoxy)cyclohexyl]-2,3,4a,5,6,7,8,8a-octahydro-1H-quinoxaline |
| SMILES | Cc1ccccc1O[C@@H]1CCCC[C@H]1N1CCN[C@@H]2CCCC[C@@H]21 |
| InChI | InChI=1S/C21H32N2O/c1-16-8-2-6-12-20(16)24-21-13-7-5-11-19(21)23-15-14-22-17-9-3-4-10-18(17)23/h2,6,8,12,17-19,21-22H,3-5,7,9-11,13-15H2,1H3/t17-,18+,19-,21-/m1/s1 |
| InChIKey | AYRHIEIVWIXGOF-RCLSDMTESA-N |
| XLogP | 3.90 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.50 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |