C12H28N2O6S2 — CID 139453520
N-(2-hydroxy-2-methylpropyl)-2-[2-(propan-2-ylsulfonylamino)ethoxy]propane-2-sulfonamide (PubChem CID 139453520) has the molecular formula C12H28N2O6S2 and a molecular weight of 360.50 g/mol. Its IUPAC name is N-(2-hydroxy-2-methylpropyl)-2-[2-(propan-2-ylsulfonylamino)ethoxy]propane-2-sulfonamide.
| Compound Name | N-(2-hydroxy-2-methylpropyl)-2-[2-(propan-2-ylsulfonylamino)ethoxy]propane-2-sulfonamide |
|---|---|
| PubChem CID | 139453520 |
| Molecular Formula | C12H28N2O6S2 |
| Molecular Weight | 360.50 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | N-(2-hydroxy-2-methylpropyl)-2-[2-(propan-2-ylsulfonylamino)ethoxy]propane-2-sulfonamide |
| SMILES | CC(C)S(=O)(=O)NCCOC(C)(C)S(=O)(=O)NCC(C)(C)O |
| InChI | InChI=1S/C12H28N2O6S2/c1-10(2)21(16,17)13-7-8-20-12(5,6)22(18,19)14-9-11(3,4)15/h10,13-15H,7-9H2,1-6H3 |
| InChIKey | WENRSNHITUTKDD-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.50 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|