C28H28ClFN3O3P — CID 139454960
1-(4-chloro-2-fluorophenyl)-3-[(3R)-1-[2-cyclopropyl-4-(2-dimethylphosphorylphenyl)phenyl]-2-oxopyrrolidin-3-yl]urea (PubChem CID 139454960) has the molecular formula C28H28ClFN3O3P and a molecular weight of 539.98 g/mol. Its IUPAC name is 1-(4-chloro-2-fluorophenyl)-3-[(3R)-1-[2-cyclopropyl-4-(2-dimethylphosphorylphenyl)phenyl]-2-oxopyrrolidin-3-yl]urea.
| Compound Name | 1-(4-chloro-2-fluorophenyl)-3-[(3R)-1-[2-cyclopropyl-4-(2-dimethylphosphorylphenyl)phenyl]-2-oxopyrrolidin-3-yl]urea |
|---|---|
| PubChem CID | 139454960 |
| Molecular Formula | C28H28ClFN3O3P |
| Molecular Weight | 539.98 g/mol |
| Exact Mass | 539.15 |
| IUPAC Name | 1-(4-chloro-2-fluorophenyl)-3-[(3R)-1-[2-cyclopropyl-4-(2-dimethylphosphorylphenyl)phenyl]-2-oxopyrrolidin-3-yl]urea |
| SMILES | CP(C)(=O)c1ccccc1-c1ccc(N2CC[C@@H](NC(=O)Nc3ccc(Cl)cc3F)C2=O)c(C2CC2)c1 |
| InChI | InChI=1S/C28H28ClFN3O3P/c1-37(2,36)26-6-4-3-5-20(26)18-9-12-25(21(15-18)17-7-8-17)33-14-13-24(27(33)34)32-28(35)31-23-11-10-19(29)16-22(23)30/h3-6,9-12,15-17,24H,7-8,13-14H2,1-2H3,(H2,31,32,35)/t24-/m1/s1 |
| InChIKey | IRNKZPKJQPFFNB-XMMPIXPASA-N |
| XLogP | 6.20 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.98 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|