C20H19F4N2O4P — CID 139451019
[1-[4-(2-dimethylphosphorylphenyl)-3-fluoro-2-(trifluoromethyl)phenyl]-2-oxopyrrolidin-3-yl]carbamic acid (PubChem CID 139451019) has the molecular formula C20H19F4N2O4P and a molecular weight of 458.35 g/mol. Its IUPAC name is [1-[4-(2-dimethylphosphorylphenyl)-3-fluoro-2-(trifluoromethyl)phenyl]-2-oxopyrrolidin-3-yl]carbamic acid.
| Compound Name | [1-[4-(2-dimethylphosphorylphenyl)-3-fluoro-2-(trifluoromethyl)phenyl]-2-oxopyrrolidin-3-yl]carbamic acid |
|---|---|
| PubChem CID | 139451019 |
| Molecular Formula | C20H19F4N2O4P |
| Molecular Weight | 458.35 g/mol |
| Exact Mass | 458.10 |
| IUPAC Name | [1-[4-(2-dimethylphosphorylphenyl)-3-fluoro-2-(trifluoromethyl)phenyl]-2-oxopyrrolidin-3-yl]carbamic acid |
| SMILES | CP(C)(=O)c1ccccc1-c1ccc(N2CCC(NC(=O)O)C2=O)c(C(F)(F)F)c1F |
| InChI | InChI=1S/C20H19F4N2O4P/c1-31(2,30)15-6-4-3-5-11(15)12-7-8-14(16(17(12)21)20(22,23)24)26-10-9-13(18(26)27)25-19(28)29/h3-8,13,25H,9-10H2,1-2H3,(H,28,29) |
| InChIKey | PPNQVJDCXDTHKC-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.35 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|