C18H19F2N2O2P — CID 139450980
(3R)-3-amino-1-[4-(2-dimethylphosphorylphenyl)-2,3-difluorophenyl]pyrrolidin-2-one (PubChem CID 139450980) has the molecular formula C18H19F2N2O2P and a molecular weight of 364.33 g/mol. Its IUPAC name is (3R)-3-amino-1-[4-(2-dimethylphosphorylphenyl)-2,3-difluorophenyl]pyrrolidin-2-one.
| Compound Name | (3R)-3-amino-1-[4-(2-dimethylphosphorylphenyl)-2,3-difluorophenyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 139450980 |
| Molecular Formula | C18H19F2N2O2P |
| Molecular Weight | 364.33 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | (3R)-3-amino-1-[4-(2-dimethylphosphorylphenyl)-2,3-difluorophenyl]pyrrolidin-2-one |
| SMILES | CP(C)(=O)c1ccccc1-c1ccc(N2CC[C@@H](N)C2=O)c(F)c1F |
| InChI | InChI=1S/C18H19F2N2O2P/c1-25(2,24)15-6-4-3-5-11(15)12-7-8-14(17(20)16(12)19)22-10-9-13(21)18(22)23/h3-8,13H,9-10,21H2,1-2H3/t13-/m1/s1 |
| InChIKey | WVCDQBJEGWPDRF-CYBMUJFWSA-N |
| XLogP | 2.94 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.33 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|