C21H22F3N7O3S — CID 139455719
12-ethylsulfonyl-5-(1H-pyrrolo[2,3-b]pyridin-3-yl)-N-(2,2,2-trifluoroethyl)-4,6,8,12-tetrazatricyclo[7.3.1.02,7]trideca-2,4,6-triene-9-carboxamide (PubChem CID 139455719) has the molecular formula C21H22F3N7O3S and a molecular weight of 509.51 g/mol. Its IUPAC name is 12-ethylsulfonyl-5-(1H-pyrrolo[2,3-b]pyridin-3-yl)-N-(2,2,2-trifluoroethyl)-4,6,8,12-tetrazatricyclo[7.3.1.02,7]trideca-2,4,6-triene-9-carboxamide.
| Compound Name | 12-ethylsulfonyl-5-(1H-pyrrolo[2,3-b]pyridin-3-yl)-N-(2,2,2-trifluoroethyl)-4,6,8,12-tetrazatricyclo[7.3.1.02,7]trideca-2,4,6-triene-9-carboxamide |
|---|---|
| PubChem CID | 139455719 |
| Molecular Formula | C21H22F3N7O3S |
| Molecular Weight | 509.51 g/mol |
| Exact Mass | 509.15 |
| IUPAC Name | 12-ethylsulfonyl-5-(1H-pyrrolo[2,3-b]pyridin-3-yl)-N-(2,2,2-trifluoroethyl)-4,6,8,12-tetrazatricyclo[7.3.1.02,7]trideca-2,4,6-triene-9-carboxamide |
| SMILES | CCS(=O)(=O)N1CCC2(C(=O)NCC(F)(F)F)CC1c1cnc(-c3c[nH]c4ncccc34)nc1N2 |
| InChI | InChI=1S/C21H22F3N7O3S/c1-2-35(33,34)31-7-5-20(19(32)28-11-21(22,23)24)8-15(31)14-10-27-17(29-18(14)30-20)13-9-26-16-12(13)4-3-6-25-16/h3-4,6,9-10,15H,2,5,7-8,11H2,1H3,(H,25,26)(H,28,32)(H,27,29,30) |
| InChIKey | VNVAQUATXZFABN-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 132.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.51 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |