C18H19F3N7O4- — CID 77107563
(2R)-2-methyl-2-[[2-(1H-pyrrolo[2,3-b]pyridin-3-yl)pyrimidin-4-yl]amino]-N-(2,2,2-trifluoroethyl)butanamide nitrate (PubChem CID 77107563) has the molecular formula C18H19F3N7O4- and a molecular weight of 454.39 g/mol. Its IUPAC name is (2R)-2-methyl-2-[[2-(1H-pyrrolo[2,3-b]pyridin-3-yl)pyrimidin-4-yl]amino]-N-(2,2,2-trifluoroethyl)butanamide nitrate.
| Compound Name | (2R)-2-methyl-2-[[2-(1H-pyrrolo[2,3-b]pyridin-3-yl)pyrimidin-4-yl]amino]-N-(2,2,2-trifluoroethyl)butanamide nitrate |
|---|---|
| PubChem CID | 77107563 |
| Molecular Formula | C18H19F3N7O4- |
| Molecular Weight | 454.39 g/mol |
| Exact Mass | 454.15 |
| IUPAC Name | (2R)-2-methyl-2-[[2-(1H-pyrrolo[2,3-b]pyridin-3-yl)pyrimidin-4-yl]amino]-N-(2,2,2-trifluoroethyl)butanamide nitrate |
| SMILES | CC[C@@](C)(Nc1ccnc(-c2c[nH]c3ncccc23)n1)C(=O)NCC(F)(F)F.O=[N+]([O-])[O-] |
| InChI | InChI=1S/C18H19F3N6O.NO3/c1-3-17(2,16(28)25-10-18(19,20)21)27-13-6-8-23-15(26-13)12-9-24-14-11(12)5-4-7-22-14;2-1(3)4/h4-9H,3,10H2,1-2H3,(H,22,24)(H,25,28)(H,23,26,27);/q;-1/t17-;/m1./s1 |
| InChIKey | VOFSYOYMIGTLJQ-UNTBIKODSA-N |
| XLogP | 3.04 |
| TPSA | 161.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.39 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|