C17H17ClF3N7O — CID 59422180
(2R)-2-[[4-(5-chloro-1H-pyrrolo[2,3-b]pyridin-3-yl)-1,3,5-triazin-2-yl]amino]-2-methyl-N-(2,2,2-trifluoroethyl)butanamide (PubChem CID 59422180) has the molecular formula C17H17ClF3N7O and a molecular weight of 427.82 g/mol. Its IUPAC name is (2R)-2-[[4-(5-chloro-1H-pyrrolo[2,3-b]pyridin-3-yl)-1,3,5-triazin-2-yl]amino]-2-methyl-N-(2,2,2-trifluoroethyl)butanamide.
| Compound Name | (2R)-2-[[4-(5-chloro-1H-pyrrolo[2,3-b]pyridin-3-yl)-1,3,5-triazin-2-yl]amino]-2-methyl-N-(2,2,2-trifluoroethyl)butanamide |
|---|---|
| PubChem CID | 59422180 |
| Molecular Formula | C17H17ClF3N7O |
| Molecular Weight | 427.82 g/mol |
| Exact Mass | 427.11 |
| IUPAC Name | (2R)-2-[[4-(5-chloro-1H-pyrrolo[2,3-b]pyridin-3-yl)-1,3,5-triazin-2-yl]amino]-2-methyl-N-(2,2,2-trifluoroethyl)butanamide |
| SMILES | CC[C@@](C)(Nc1ncnc(-c2c[nH]c3ncc(Cl)cc23)n1)C(=O)NCC(F)(F)F |
| InChI | InChI=1S/C17H17ClF3N7O/c1-3-16(2,14(29)24-7-17(19,20)21)28-15-26-8-25-13(27-15)11-6-23-12-10(11)4-9(18)5-22-12/h4-6,8H,3,7H2,1-2H3,(H,22,23)(H,24,29)(H,25,26,27,28)/t16-/m1/s1 |
| InChIKey | LZWHHPSUQNVUBE-MRXNPFEDSA-N |
| XLogP | 3.33 |
| TPSA | 108.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.82 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |