C16H19ClF3N7O — CID 160992024
(2R)-2-[[4-(5-chloro-1H-pyrrolo[2,3-b]pyridin-3-yl)-1,3,5-triazin-2-yl]amino]-N-(2,2,2-trifluoroethyl)butanamide;molecular hydrogen (PubChem CID 160992024) has the molecular formula C16H19ClF3N7O and a molecular weight of 417.82 g/mol. Its IUPAC name is (2R)-2-[[4-(5-chloro-1H-pyrrolo[2,3-b]pyridin-3-yl)-1,3,5-triazin-2-yl]amino]-N-(2,2,2-trifluoroethyl)butanamide;molecular hydrogen.
| Compound Name | (2R)-2-[[4-(5-chloro-1H-pyrrolo[2,3-b]pyridin-3-yl)-1,3,5-triazin-2-yl]amino]-N-(2,2,2-trifluoroethyl)butanamide;molecular hydrogen |
|---|---|
| PubChem CID | 160992024 |
| Molecular Formula | C16H19ClF3N7O |
| Molecular Weight | 417.82 g/mol |
| Exact Mass | 417.13 |
| IUPAC Name | (2R)-2-[[4-(5-chloro-1H-pyrrolo[2,3-b]pyridin-3-yl)-1,3,5-triazin-2-yl]amino]-N-(2,2,2-trifluoroethyl)butanamide;molecular hydrogen |
| SMILES | CC[C@@H](Nc1ncnc(-c2c[nH]c3ncc(Cl)cc23)n1)C(=O)NCC(F)(F)F.[H][H].[H][H] |
| InChI | InChI=1S/C16H15ClF3N7O.2H2/c1-2-11(14(28)23-6-16(18,19)20)26-15-25-7-24-13(27-15)10-5-22-12-9(10)3-8(17)4-21-12;;/h3-5,7,11H,2,6H2,1H3,(H,21,22)(H,23,28)(H,24,25,26,27);2*1H/t11-;;/m1../s1 |
| InChIKey | TUTHFZXRPHRXPF-NVJADKKVSA-N |
| XLogP | 3.43 |
| TPSA | 108.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.82 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |