C17H17ClF3N7O — CID 89488207
(2S)-2-amino-2-[3-(5-chloro-1H-pyrrolo[2,3-b]pyridin-3-yl)-1,2,4-triazin-5-yl]-3-methyl-N-(2,2,2-trifluoroethyl)butanamide (PubChem CID 89488207) has the molecular formula C17H17ClF3N7O and a molecular weight of 427.82 g/mol. Its IUPAC name is (2S)-2-amino-2-[3-(5-chloro-1H-pyrrolo[2,3-b]pyridin-3-yl)-1,2,4-triazin-5-yl]-3-methyl-N-(2,2,2-trifluoroethyl)butanamide.
| Compound Name | (2S)-2-amino-2-[3-(5-chloro-1H-pyrrolo[2,3-b]pyridin-3-yl)-1,2,4-triazin-5-yl]-3-methyl-N-(2,2,2-trifluoroethyl)butanamide |
|---|---|
| PubChem CID | 89488207 |
| Molecular Formula | C17H17ClF3N7O |
| Molecular Weight | 427.82 g/mol |
| Exact Mass | 427.11 |
| IUPAC Name | (2S)-2-amino-2-[3-(5-chloro-1H-pyrrolo[2,3-b]pyridin-3-yl)-1,2,4-triazin-5-yl]-3-methyl-N-(2,2,2-trifluoroethyl)butanamide |
| SMILES | CC(C)[C@@](N)(C(=O)NCC(F)(F)F)c1cnnc(-c2c[nH]c3ncc(Cl)cc23)n1 |
| InChI | InChI=1S/C17H17ClF3N7O/c1-8(2)17(22,15(29)25-7-16(19,20)21)12-6-26-28-14(27-12)11-5-24-13-10(11)3-9(18)4-23-13/h3-6,8H,7,22H2,1-2H3,(H,23,24)(H,25,29)/t17-/m0/s1 |
| InChIKey | UUKHZRXXCPTBIW-KRWDZBQOSA-N |
| XLogP | 2.56 |
| TPSA | 122.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.82 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |