C15H13F4N7O — CID 89488214
(2S)-2-[3-(5-fluoro-1H-pyrrolo[2,3-b]pyridin-3-yl)-1,2,4-triazin-5-yl]-2-(2,2,2-trifluoroethylamino)propanamide (PubChem CID 89488214) has the molecular formula C15H13F4N7O and a molecular weight of 383.31 g/mol. Its IUPAC name is (2S)-2-[3-(5-fluoro-1H-pyrrolo[2,3-b]pyridin-3-yl)-1,2,4-triazin-5-yl]-2-(2,2,2-trifluoroethylamino)propanamide.
| Compound Name | (2S)-2-[3-(5-fluoro-1H-pyrrolo[2,3-b]pyridin-3-yl)-1,2,4-triazin-5-yl]-2-(2,2,2-trifluoroethylamino)propanamide |
|---|---|
| PubChem CID | 89488214 |
| Molecular Formula | C15H13F4N7O |
| Molecular Weight | 383.31 g/mol |
| Exact Mass | 383.11 |
| IUPAC Name | (2S)-2-[3-(5-fluoro-1H-pyrrolo[2,3-b]pyridin-3-yl)-1,2,4-triazin-5-yl]-2-(2,2,2-trifluoroethylamino)propanamide |
| SMILES | C[C@@](NCC(F)(F)F)(C(N)=O)c1cnnc(-c2c[nH]c3ncc(F)cc23)n1 |
| InChI | InChI=1S/C15H13F4N7O/c1-14(13(20)27,23-6-15(17,18)19)10-5-24-26-12(25-10)9-4-22-11-8(9)2-7(16)3-21-11/h2-5,23H,6H2,1H3,(H2,20,27)(H,21,22)/t14-/m0/s1 |
| InChIKey | HSBHBJZJOONEAT-AWEZNQCLSA-N |
| XLogP | 1.41 |
| TPSA | 122.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.31 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |