C15H13F4N7O — CID 123633229
2-[[3-(5-fluoro-1H-pyrrolo[2,3-b]pyridin-3-yl)-1,2,4-triazin-5-yl]amino]-N-(2,2,2-trifluoroethyl)propanamide (PubChem CID 123633229) has the molecular formula C15H13F4N7O and a molecular weight of 383.31 g/mol. Its IUPAC name is 2-[[3-(5-fluoro-1H-pyrrolo[2,3-b]pyridin-3-yl)-1,2,4-triazin-5-yl]amino]-N-(2,2,2-trifluoroethyl)propanamide.
| Compound Name | 2-[[3-(5-fluoro-1H-pyrrolo[2,3-b]pyridin-3-yl)-1,2,4-triazin-5-yl]amino]-N-(2,2,2-trifluoroethyl)propanamide |
|---|---|
| PubChem CID | 123633229 |
| Molecular Formula | C15H13F4N7O |
| Molecular Weight | 383.31 g/mol |
| Exact Mass | 383.11 |
| IUPAC Name | 2-[[3-(5-fluoro-1H-pyrrolo[2,3-b]pyridin-3-yl)-1,2,4-triazin-5-yl]amino]-N-(2,2,2-trifluoroethyl)propanamide |
| SMILES | CC(Nc1cnnc(-c2c[nH]c3ncc(F)cc23)n1)C(=O)NCC(F)(F)F |
| InChI | InChI=1S/C15H13F4N7O/c1-7(14(27)22-6-15(17,18)19)24-11-5-23-26-13(25-11)10-4-21-12-9(10)2-8(16)3-20-12/h2-5,7H,6H2,1H3,(H,20,21)(H,22,27)(H,24,25,26) |
| InChIKey | ZKOWGDSRMYEMSM-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 108.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.31 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |