C19H22F3N9O — CID 143435843
2-[[4-pyrrolidin-1-yl-6-(7H-pyrrolo[2,3-d]pyrimidin-5-yl)-1,3,5-triazin-2-yl]amino]-N-(2,2,2-trifluoroethyl)butanamide (PubChem CID 143435843) has the molecular formula C19H22F3N9O and a molecular weight of 449.44 g/mol. Its IUPAC name is 2-[[4-pyrrolidin-1-yl-6-(7H-pyrrolo[2,3-d]pyrimidin-5-yl)-1,3,5-triazin-2-yl]amino]-N-(2,2,2-trifluoroethyl)butanamide.
| Compound Name | 2-[[4-pyrrolidin-1-yl-6-(7H-pyrrolo[2,3-d]pyrimidin-5-yl)-1,3,5-triazin-2-yl]amino]-N-(2,2,2-trifluoroethyl)butanamide |
|---|---|
| PubChem CID | 143435843 |
| Molecular Formula | C19H22F3N9O |
| Molecular Weight | 449.44 g/mol |
| Exact Mass | 449.19 |
| IUPAC Name | 2-[[4-pyrrolidin-1-yl-6-(7H-pyrrolo[2,3-d]pyrimidin-5-yl)-1,3,5-triazin-2-yl]amino]-N-(2,2,2-trifluoroethyl)butanamide |
| SMILES | CCC(Nc1nc(-c2c[nH]c3ncncc23)nc(N2CCCC2)n1)C(=O)NCC(F)(F)F |
| InChI | InChI=1S/C19H22F3N9O/c1-2-13(16(32)25-9-19(20,21)22)27-17-28-15(29-18(30-17)31-5-3-4-6-31)12-8-24-14-11(12)7-23-10-26-14/h7-8,10,13H,2-6,9H2,1H3,(H,25,32)(H,23,24,26)(H,27,28,29,30) |
| InChIKey | MEGGJKFHBKQUGF-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 124.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.44 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |