C16H26N2 — CID 139456189
1-[1-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-3-methylazetidin-3-yl]piperidine (PubChem CID 139456189) has the molecular formula C16H26N2 and a molecular weight of 246.40 g/mol. Its IUPAC name is 1-[1-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-3-methylazetidin-3-yl]piperidine.
| Compound Name | 1-[1-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-3-methylazetidin-3-yl]piperidine |
|---|---|
| PubChem CID | 139456189 |
| Molecular Formula | C16H26N2 |
| Molecular Weight | 246.40 g/mol |
| Exact Mass | 246.21 |
| IUPAC Name | 1-[1-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-3-methylazetidin-3-yl]piperidine |
| SMILES | C=C/C=C\C=C(/C)N1CC(C)(N2CCCCC2)C1 |
| InChI | InChI=1S/C16H26N2/c1-4-5-7-10-15(2)17-13-16(3,14-17)18-11-8-6-9-12-18/h4-5,7,10H,1,6,8-9,11-14H2,2-3H3/b7-5-,15-10+ |
| InChIKey | RYZDBPRIILSLGR-VHLXWLPASA-N |
| XLogP | 3.19 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.40 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|