C15H24N2 — CID 176937509
3-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-6-propan-2-yl-3,6-diazabicyclo[3.1.1]heptane (PubChem CID 176937509) has the molecular formula C15H24N2 and a molecular weight of 232.37 g/mol. Its IUPAC name is 3-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-6-propan-2-yl-3,6-diazabicyclo[3.1.1]heptane.
| Compound Name | 3-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-6-propan-2-yl-3,6-diazabicyclo[3.1.1]heptane |
|---|---|
| PubChem CID | 176937509 |
| Molecular Formula | C15H24N2 |
| Molecular Weight | 232.37 g/mol |
| Exact Mass | 232.19 |
| IUPAC Name | 3-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-6-propan-2-yl-3,6-diazabicyclo[3.1.1]heptane |
| SMILES | C=C/C(=C\C=C/C)N1CC2CC(C1)N2C(C)C |
| InChI | InChI=1S/C15H24N2/c1-5-7-8-13(6-2)16-10-14-9-15(11-16)17(14)12(3)4/h5-8,12,14-15H,2,9-11H2,1,3-4H3/b7-5-,13-8+ |
| InChIKey | JUTDTYVCKFSTIG-IPYMFYIGSA-N |
| XLogP | 2.80 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.37 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|