C23H25BrN4O2 — CID 139457751
5-bromo-1-[(1R)-1-[3-[5-(piperidin-4-ylmethoxy)pyrimidin-2-yl]phenyl]ethyl]pyridin-2-one (PubChem CID 139457751) has the molecular formula C23H25BrN4O2 and a molecular weight of 469.38 g/mol. Its IUPAC name is 5-bromo-1-[(1R)-1-[3-[5-(piperidin-4-ylmethoxy)pyrimidin-2-yl]phenyl]ethyl]pyridin-2-one.
| Compound Name | 5-bromo-1-[(1R)-1-[3-[5-(piperidin-4-ylmethoxy)pyrimidin-2-yl]phenyl]ethyl]pyridin-2-one |
|---|---|
| PubChem CID | 139457751 |
| Molecular Formula | C23H25BrN4O2 |
| Molecular Weight | 469.38 g/mol |
| Exact Mass | 468.12 |
| IUPAC Name | 5-bromo-1-[(1R)-1-[3-[5-(piperidin-4-ylmethoxy)pyrimidin-2-yl]phenyl]ethyl]pyridin-2-one |
| SMILES | C[C@H](c1cccc(-c2ncc(OCC3CCNCC3)cn2)c1)n1cc(Br)ccc1=O |
| InChI | InChI=1S/C23H25BrN4O2/c1-16(28-14-20(24)5-6-22(28)29)18-3-2-4-19(11-18)23-26-12-21(13-27-23)30-15-17-7-9-25-10-8-17/h2-6,11-14,16-17,25H,7-10,15H2,1H3/t16-/m1/s1 |
| InChIKey | JURUQXTYPJSFSX-MRXNPFEDSA-N |
| XLogP | 4.06 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.38 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |