C31H31N5O2S — CID 166876953
2-[methyl-[1-[3-[5-(piperidin-4-ylmethoxy)pyrimidin-2-yl]phenyl]ethyl]amino]-3-[(Z)-3-oxoprop-1-enyl]-1-benzothiophene-5-carbonitrile (PubChem CID 166876953) has the molecular formula C31H31N5O2S and a molecular weight of 537.69 g/mol. Its IUPAC name is 2-[methyl-[1-[3-[5-(piperidin-4-ylmethoxy)pyrimidin-2-yl]phenyl]ethyl]amino]-3-[(Z)-3-oxoprop-1-enyl]-1-benzothiophene-5-carbonitrile.
| Compound Name | 2-[methyl-[1-[3-[5-(piperidin-4-ylmethoxy)pyrimidin-2-yl]phenyl]ethyl]amino]-3-[(Z)-3-oxoprop-1-enyl]-1-benzothiophene-5-carbonitrile |
|---|---|
| PubChem CID | 166876953 |
| Molecular Formula | C31H31N5O2S |
| Molecular Weight | 537.69 g/mol |
| Exact Mass | 537.22 |
| IUPAC Name | 2-[methyl-[1-[3-[5-(piperidin-4-ylmethoxy)pyrimidin-2-yl]phenyl]ethyl]amino]-3-[(Z)-3-oxoprop-1-enyl]-1-benzothiophene-5-carbonitrile |
| SMILES | CC(c1cccc(-c2ncc(OCC3CCNCC3)cn2)c1)N(C)c1sc2ccc(C#N)cc2c1/C=C\C=O |
| InChI | InChI=1S/C31H31N5O2S/c1-21(36(2)31-27(7-4-14-37)28-15-23(17-32)8-9-29(28)39-31)24-5-3-6-25(16-24)30-34-18-26(19-35-30)38-20-22-10-12-33-13-11-22/h3-9,14-16,18-19,21-22,33H,10-13,20H2,1-2H3/b7-4- |
| InChIKey | ULFBYDNVJIASSL-DAXSKMNVSA-N |
| XLogP | 6.02 |
| TPSA | 91.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.69 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|