C24H24FNO2 — CID 139459019
1-[6-[3-fluoro-5-(2-methylpropoxy)phenyl]-2-(4-methylphenyl)-3-pyridinyl]ethanone (PubChem CID 139459019) has the molecular formula C24H24FNO2 and a molecular weight of 377.46 g/mol. Its IUPAC name is 1-[6-[3-fluoro-5-(2-methylpropoxy)phenyl]-2-(4-methylphenyl)-3-pyridinyl]ethanone.
| Compound Name | 1-[6-[3-fluoro-5-(2-methylpropoxy)phenyl]-2-(4-methylphenyl)-3-pyridinyl]ethanone |
|---|---|
| PubChem CID | 139459019 |
| Molecular Formula | C24H24FNO2 |
| Molecular Weight | 377.46 g/mol |
| Exact Mass | 377.18 |
| IUPAC Name | 1-[6-[3-fluoro-5-(2-methylpropoxy)phenyl]-2-(4-methylphenyl)-3-pyridinyl]ethanone |
| SMILES | CC(=O)c1ccc(-c2cc(F)cc(OCC(C)C)c2)nc1-c1ccc(C)cc1 |
| InChI | InChI=1S/C24H24FNO2/c1-15(2)14-28-21-12-19(11-20(25)13-21)23-10-9-22(17(4)27)24(26-23)18-7-5-16(3)6-8-18/h5-13,15H,14H2,1-4H3 |
| InChIKey | CJRRDVADZIWXNF-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.46 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |