C20H27ClFNO3 — CID 153336072
2-chloro-6-[3-fluoro-5-(2-methylpropoxy)phenyl]pyridine-3-carboxylic acid;ethane (PubChem CID 153336072) has the molecular formula C20H27ClFNO3 and a molecular weight of 383.89 g/mol. Its IUPAC name is 2-chloro-6-[3-fluoro-5-(2-methylpropoxy)phenyl]pyridine-3-carboxylic acid;ethane.
| Compound Name | 2-chloro-6-[3-fluoro-5-(2-methylpropoxy)phenyl]pyridine-3-carboxylic acid;ethane |
|---|---|
| PubChem CID | 153336072 |
| Molecular Formula | C20H27ClFNO3 |
| Molecular Weight | 383.89 g/mol |
| Exact Mass | 383.17 |
| IUPAC Name | 2-chloro-6-[3-fluoro-5-(2-methylpropoxy)phenyl]pyridine-3-carboxylic acid;ethane |
| SMILES | CC.CC.CC(C)COc1cc(F)cc(-c2ccc(C(=O)O)c(Cl)n2)c1 |
| InChI | InChI=1S/C16H15ClFNO3.2C2H6/c1-9(2)8-22-12-6-10(5-11(18)7-12)14-4-3-13(16(20)21)15(17)19-14;2*1-2/h3-7,9H,8H2,1-2H3,(H,20,21);2*1-2H3 |
| InChIKey | DXPYFWUASLMELC-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.89 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|