C12H8N2O — CID 139462464
pyrido[1,2-h][1,7]naphthyridin-10-one (PubChem CID 139462464) has the molecular formula C12H8N2O and a molecular weight of 196.21 g/mol. Its IUPAC name is pyrido[1,2-h][1,7]naphthyridin-10-one.
| Compound Name | pyrido[1,2-h][1,7]naphthyridin-10-one |
|---|---|
| PubChem CID | 139462464 |
| Molecular Formula | C12H8N2O |
| Molecular Weight | 196.21 g/mol |
| Exact Mass | 196.06 |
| IUPAC Name | pyrido[1,2-h][1,7]naphthyridin-10-one |
| SMILES | O=c1ccn2ccc3cccnc3c2c1 |
| InChI | InChI=1S/C12H8N2O/c15-10-4-7-14-6-3-9-2-1-5-13-12(9)11(14)8-10/h1-8H |
| InChIKey | XOZSVCGZKLTKIP-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 34.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.21 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|