C24H33F3N6O3 — CID 139463752
(2S)-4-[2-methoxyethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-[[2-(trifluoromethyl)pyrimidin-4-yl]amino]butanoic acid (PubChem CID 139463752) has the molecular formula C24H33F3N6O3 and a molecular weight of 510.56 g/mol. Its IUPAC name is (2S)-4-[2-methoxyethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-[[2-(trifluoromethyl)pyrimidin-4-yl]amino]butanoic acid.
| Compound Name | (2S)-4-[2-methoxyethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-[[2-(trifluoromethyl)pyrimidin-4-yl]amino]butanoic acid |
|---|---|
| PubChem CID | 139463752 |
| Molecular Formula | C24H33F3N6O3 |
| Molecular Weight | 510.56 g/mol |
| Exact Mass | 510.26 |
| IUPAC Name | (2S)-4-[2-methoxyethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-[[2-(trifluoromethyl)pyrimidin-4-yl]amino]butanoic acid |
| SMILES | COCCN(CCCCc1ccc2c(n1)NCCC2)CC[C@H](Nc1ccnc(C(F)(F)F)n1)C(=O)O |
| InChI | InChI=1S/C24H33F3N6O3/c1-36-16-15-33(13-3-2-6-18-8-7-17-5-4-11-28-21(17)30-18)14-10-19(22(34)35)31-20-9-12-29-23(32-20)24(25,26)27/h7-9,12,19H,2-6,10-11,13-16H2,1H3,(H,28,30)(H,34,35)(H,29,31,32)/t19-/m0/s1 |
| InChIKey | DRPFMHBSKICVQX-IBGZPJMESA-N |
| XLogP | 3.47 |
| TPSA | 112.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.56 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|