2-[4-(4-chlorobutoxy)butoxy]acetyl chloride

C10H18Cl2O3 — CID 139466008

IUPAC2-[4-(4-chlorobutoxy)butoxy]acetyl chloride
SMILESO=C(Cl)COCCCCOCCCCCl
InChIInChI=1S/C10H18Cl2O3/c11-5-1-2-6-14-7-3-4-8-15-9-10(12)13/h1-9H2
InChIKeyWDFMKKCLONFLCM-UHFFFAOYSA-N
MW257.16 g/mol
LogP2.58
Rot. Bonds11

About 2-[4-(4-chlorobutoxy)butoxy]acetyl chloride

2-[4-(4-chlorobutoxy)butoxy]acetyl chloride (PubChem CID 139466008) has the molecular formula C10H18Cl2O3 and a molecular weight of 257.16 g/mol. Its IUPAC name is 2-[4-(4-chlorobutoxy)butoxy]acetyl chloride.

Molecular Properties

Compound Name2-[4-(4-chlorobutoxy)butoxy]acetyl chloride
PubChem CID139466008
Molecular FormulaC10H18Cl2O3
Molecular Weight257.16 g/mol
Exact Mass256.06
IUPAC Name2-[4-(4-chlorobutoxy)butoxy]acetyl chloride
SMILESO=C(Cl)COCCCCOCCCCCl
InChIInChI=1S/C10H18Cl2O3/c11-5-1-2-6-14-7-3-4-8-15-9-10(12)13/h1-9H2
InChIKeyWDFMKKCLONFLCM-UHFFFAOYSA-N
XLogP2.58
TPSA35.53 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds11
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500257.16
LogP ≤ 52.58
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}

Analyze 2-[4-(4-chlorobutoxy)butoxy]acetyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[4-(4-chlorobutoxy)butoxy]acetyl chloride?
The IUPAC name of 2-[4-(4-chlorobutoxy)butoxy]acetyl chloride (CID 139466008) is 2-[4-(4-chlorobutoxy)butoxy]acetyl chloride.
What is the SMILES notation for 2-[4-(4-chlorobutoxy)butoxy]acetyl chloride?
The canonical SMILES for 2-[4-(4-chlorobutoxy)butoxy]acetyl chloride is O=C(Cl)COCCCCOCCCCCl.
What is the InChIKey of 2-[4-(4-chlorobutoxy)butoxy]acetyl chloride?
The InChIKey is WDFMKKCLONFLCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18Cl2O3/c11-5-1-2-6-14-7-3-4-8-15-9-10(12)13/h1-9H2.
What are the key properties of 2-[4-(4-chlorobutoxy)butoxy]acetyl chloride?
2-[4-(4-chlorobutoxy)butoxy]acetyl chloride has a molecular weight of 257.16 g/mol, XLogP of 2.58, 11 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(4-chlorobutoxy)butoxy]acetyl chloride is sourced from PubChem (CID 139466008), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).