3-(3-bromopropoxy)propanoyl chloride

C6H10BrClO2 — CID 86619721

IUPAC3-(3-bromopropoxy)propanoyl chloride
SMILESO=C(Cl)CCOCCCBr
InChIInChI=1S/C6H10BrClO2/c7-3-1-4-10-5-2-6(8)9/h1-5H2
InChIKeyKUHICGPFYYVNHU-UHFFFAOYSA-N
MW229.50 g/mol
LogP1.94
Rot. Bonds6

About 3-(3-bromopropoxy)propanoyl chloride

3-(3-bromopropoxy)propanoyl chloride (PubChem CID 86619721) has the molecular formula C6H10BrClO2 and a molecular weight of 229.50 g/mol. Its IUPAC name is 3-(3-bromopropoxy)propanoyl chloride.

Molecular Properties

Compound Name3-(3-bromopropoxy)propanoyl chloride
PubChem CID86619721
Molecular FormulaC6H10BrClO2
Molecular Weight229.50 g/mol
Exact Mass227.96
IUPAC Name3-(3-bromopropoxy)propanoyl chloride
SMILESO=C(Cl)CCOCCCBr
InChIInChI=1S/C6H10BrClO2/c7-3-1-4-10-5-2-6(8)9/h1-5H2
InChIKeyKUHICGPFYYVNHU-UHFFFAOYSA-N
XLogP1.94
TPSA26.30 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds6
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500229.50
LogP ≤ 51.94
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}

Analyze 3-(3-bromopropoxy)propanoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(3-bromopropoxy)propanoyl chloride?
The IUPAC name of 3-(3-bromopropoxy)propanoyl chloride (CID 86619721) is 3-(3-bromopropoxy)propanoyl chloride.
What is the SMILES notation for 3-(3-bromopropoxy)propanoyl chloride?
The canonical SMILES for 3-(3-bromopropoxy)propanoyl chloride is O=C(Cl)CCOCCCBr.
What is the InChIKey of 3-(3-bromopropoxy)propanoyl chloride?
The InChIKey is KUHICGPFYYVNHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10BrClO2/c7-3-1-4-10-5-2-6(8)9/h1-5H2.
What are the key properties of 3-(3-bromopropoxy)propanoyl chloride?
3-(3-bromopropoxy)propanoyl chloride has a molecular weight of 229.50 g/mol, XLogP of 1.94, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-bromopropoxy)propanoyl chloride is sourced from PubChem (CID 86619721), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).