C31H42N8O2 — CID 139467818
(2S)-4-[2-(3,5-dimethylpyrazol-1-yl)ethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-[(1-methylindazol-3-yl)amino]butanoic acid (PubChem CID 139467818) has the molecular formula C31H42N8O2 and a molecular weight of 558.73 g/mol. Its IUPAC name is (2S)-4-[2-(3,5-dimethylpyrazol-1-yl)ethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-[(1-methylindazol-3-yl)amino]butanoic acid.
| Compound Name | (2S)-4-[2-(3,5-dimethylpyrazol-1-yl)ethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-[(1-methylindazol-3-yl)amino]butanoic acid |
|---|---|
| PubChem CID | 139467818 |
| Molecular Formula | C31H42N8O2 |
| Molecular Weight | 558.73 g/mol |
| Exact Mass | 558.34 |
| IUPAC Name | (2S)-4-[2-(3,5-dimethylpyrazol-1-yl)ethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-[(1-methylindazol-3-yl)amino]butanoic acid |
| SMILES | Cc1cc(C)n(CCN(CCCCc2ccc3c(n2)NCCC3)CC[C@H](Nc2nn(C)c3ccccc23)C(=O)O)n1 |
| InChI | InChI=1S/C31H42N8O2/c1-22-21-23(2)39(35-22)20-19-38(17-7-6-10-25-14-13-24-9-8-16-32-29(24)33-25)18-15-27(31(40)41)34-30-26-11-4-5-12-28(26)37(3)36-30/h4-5,11-14,21,27H,6-10,15-20H2,1-3H3,(H,32,33)(H,34,36)(H,40,41)/t27-/m0/s1 |
| InChIKey | IBNVYRQDMQRXMZ-MHZLTWQESA-N |
| XLogP | 4.42 |
| TPSA | 113.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.73 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|