C32H47FN6O3 — CID 175082361
(2S)-6-[[(2S)-2-fluoro-3-methoxypropyl]-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-5,5-dimethyl-2-[(1-methylindazol-3-yl)amino]hexanoic acid (PubChem CID 175082361) has the molecular formula C32H47FN6O3 and a molecular weight of 582.77 g/mol. Its IUPAC name is (2S)-6-[[(2S)-2-fluoro-3-methoxypropyl]-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-5,5-dimethyl-2-[(1-methylindazol-3-yl)amino]hexanoic acid.
| Compound Name | (2S)-6-[[(2S)-2-fluoro-3-methoxypropyl]-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-5,5-dimethyl-2-[(1-methylindazol-3-yl)amino]hexanoic acid |
|---|---|
| PubChem CID | 175082361 |
| Molecular Formula | C32H47FN6O3 |
| Molecular Weight | 582.77 g/mol |
| Exact Mass | 582.37 |
| IUPAC Name | (2S)-6-[[(2S)-2-fluoro-3-methoxypropyl]-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-5,5-dimethyl-2-[(1-methylindazol-3-yl)amino]hexanoic acid |
| SMILES | COC[C@@H](F)CN(CCCCc1ccc2c(n1)NCCC2)CC(C)(C)CC[C@H](Nc1nn(C)c2ccccc12)C(=O)O |
| InChI | InChI=1S/C32H47FN6O3/c1-32(2,17-16-27(31(40)41)36-30-26-12-5-6-13-28(26)38(3)37-30)22-39(20-24(33)21-42-4)19-8-7-11-25-15-14-23-10-9-18-34-29(23)35-25/h5-6,12-15,24,27H,7-11,16-22H2,1-4H3,(H,34,35)(H,36,37)(H,40,41)/t24-,27-/m0/s1 |
| InChIKey | ZUZTTYKMVJRHHC-IGKIAQTJSA-N |
| XLogP | 5.31 |
| TPSA | 104.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.77 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|