C22H24N6O2 — CID 139468419
8-(3,4-dimethoxyphenyl)-2,7-dimethyl-N-(2-pyridin-4-ylethyl)pyrazolo[1,5-a][1,3,5]triazin-4-amine (PubChem CID 139468419) has the molecular formula C22H24N6O2 and a molecular weight of 404.47 g/mol. Its IUPAC name is 8-(3,4-dimethoxyphenyl)-2,7-dimethyl-N-(2-pyridin-4-ylethyl)pyrazolo[1,5-a][1,3,5]triazin-4-amine.
| Compound Name | 8-(3,4-dimethoxyphenyl)-2,7-dimethyl-N-(2-pyridin-4-ylethyl)pyrazolo[1,5-a][1,3,5]triazin-4-amine |
|---|---|
| PubChem CID | 139468419 |
| Molecular Formula | C22H24N6O2 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.20 |
| IUPAC Name | 8-(3,4-dimethoxyphenyl)-2,7-dimethyl-N-(2-pyridin-4-ylethyl)pyrazolo[1,5-a][1,3,5]triazin-4-amine |
| SMILES | COc1ccc(-c2c(C)nn3c(NCCc4ccncc4)nc(C)nc23)cc1OC |
| InChI | InChI=1S/C22H24N6O2/c1-14-20(17-5-6-18(29-3)19(13-17)30-4)21-25-15(2)26-22(28(21)27-14)24-12-9-16-7-10-23-11-8-16/h5-8,10-11,13H,9,12H2,1-4H3,(H,24,25,26) |
| InChIKey | HVUAUCUQBDNWOF-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |