C21H23N6O3+ — CID 145215545
8-(3,4-dimethoxyphenyl)-N-[(1-hydroxypyridin-1-ium-4-yl)methyl]-2,7-dimethylpyrazolo[1,5-a][1,3,5]triazin-4-amine (PubChem CID 145215545) has the molecular formula C21H23N6O3+ and a molecular weight of 407.45 g/mol. Its IUPAC name is 8-(3,4-dimethoxyphenyl)-N-[(1-hydroxypyridin-1-ium-4-yl)methyl]-2,7-dimethylpyrazolo[1,5-a][1,3,5]triazin-4-amine.
| Compound Name | 8-(3,4-dimethoxyphenyl)-N-[(1-hydroxypyridin-1-ium-4-yl)methyl]-2,7-dimethylpyrazolo[1,5-a][1,3,5]triazin-4-amine |
|---|---|
| PubChem CID | 145215545 |
| Molecular Formula | C21H23N6O3+ |
| Molecular Weight | 407.45 g/mol |
| Exact Mass | 407.18 |
| IUPAC Name | 8-(3,4-dimethoxyphenyl)-N-[(1-hydroxypyridin-1-ium-4-yl)methyl]-2,7-dimethylpyrazolo[1,5-a][1,3,5]triazin-4-amine |
| SMILES | COc1ccc(-c2c(C)nn3c(NCc4cc[n+](O)cc4)nc(C)nc23)cc1OC |
| InChI | InChI=1S/C21H23N6O3/c1-13-19(16-5-6-17(29-3)18(11-16)30-4)20-23-14(2)24-21(27(20)25-13)22-12-15-7-9-26(28)10-8-15/h5-11,28H,12H2,1-4H3,(H,22,23,24)/q+1 |
| InChIKey | SKLKLQVEGNWRJC-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 97.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.45 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|