C22H32N4O7 — CID 139469306
benzyl (3S)-5-amino-3-[[(2S)-3-hydroxy-2-[(5-hydroxypiperidine-3-carbonyl)amino]butanoyl]amino]-2-oxopentanoate (PubChem CID 139469306) has the molecular formula C22H32N4O7 and a molecular weight of 464.52 g/mol. Its IUPAC name is benzyl (3S)-5-amino-3-[[(2S)-3-hydroxy-2-[(5-hydroxypiperidine-3-carbonyl)amino]butanoyl]amino]-2-oxopentanoate.
| Compound Name | benzyl (3S)-5-amino-3-[[(2S)-3-hydroxy-2-[(5-hydroxypiperidine-3-carbonyl)amino]butanoyl]amino]-2-oxopentanoate |
|---|---|
| PubChem CID | 139469306 |
| Molecular Formula | C22H32N4O7 |
| Molecular Weight | 464.52 g/mol |
| Exact Mass | 464.23 |
| IUPAC Name | benzyl (3S)-5-amino-3-[[(2S)-3-hydroxy-2-[(5-hydroxypiperidine-3-carbonyl)amino]butanoyl]amino]-2-oxopentanoate |
| SMILES | CC(O)[C@H](NC(=O)C1CNCC(O)C1)C(=O)N[C@@H](CCN)C(=O)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C22H32N4O7/c1-13(27)18(26-20(30)15-9-16(28)11-24-10-15)21(31)25-17(7-8-23)19(29)22(32)33-12-14-5-3-2-4-6-14/h2-6,13,15-18,24,27-28H,7-12,23H2,1H3,(H,25,31)(H,26,30)/t13?,15?,16?,17-,18-/m0/s1 |
| InChIKey | ZXLUFAQTERCACM-NFOXXYIBSA-N |
| XLogP | -2.03 |
| TPSA | 180.08 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.52 |
| LogP ≤ 5 | -2.03 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|