C29H32N4O2 — CID 139469883
N-[[1-ethyl-6-[[1-[2-(2-phenylphenyl)propoxy]ethenylamino]methyl]benzimidazol-2-yl]methyl]formamide (PubChem CID 139469883) has the molecular formula C29H32N4O2 and a molecular weight of 468.60 g/mol. Its IUPAC name is N-[[1-ethyl-6-[[1-[2-(2-phenylphenyl)propoxy]ethenylamino]methyl]benzimidazol-2-yl]methyl]formamide.
| Compound Name | N-[[1-ethyl-6-[[1-[2-(2-phenylphenyl)propoxy]ethenylamino]methyl]benzimidazol-2-yl]methyl]formamide |
|---|---|
| PubChem CID | 139469883 |
| Molecular Formula | C29H32N4O2 |
| Molecular Weight | 468.60 g/mol |
| Exact Mass | 468.25 |
| IUPAC Name | N-[[1-ethyl-6-[[1-[2-(2-phenylphenyl)propoxy]ethenylamino]methyl]benzimidazol-2-yl]methyl]formamide |
| SMILES | C=C(NCc1ccc2nc(CNC=O)n(CC)c2c1)OCC(C)c1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C29H32N4O2/c1-4-33-28-16-23(14-15-27(28)32-29(33)18-30-20-34)17-31-22(3)35-19-21(2)25-12-8-9-13-26(25)24-10-6-5-7-11-24/h5-16,20-21,31H,3-4,17-19H2,1-2H3,(H,30,34) |
| InChIKey | GSMSKMDUYXRTSK-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.60 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|