About 2-(4-acetylphenyl)ethyl ethyl morpholin-4-ylmethyl phosphate
2-(4-acetylphenyl)ethyl ethyl morpholin-4-ylmethyl phosphate (PubChem CID 139470564) has the molecular formula C17H26NO6P
and a molecular weight of 371.37 g/mol. Its IUPAC name is 2-(4-acetylphenyl)ethyl ethyl morpholin-4-ylmethyl phosphate.
Molecular Properties
| Compound Name | 2-(4-acetylphenyl)ethyl ethyl morpholin-4-ylmethyl phosphate |
| PubChem CID | 139470564 |
| Molecular Formula | C17H26NO6P |
| Molecular Weight | 371.37 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | 2-(4-acetylphenyl)ethyl ethyl morpholin-4-ylmethyl phosphate |
| SMILES | CCOP(=O)(OCCc1ccc(C(C)=O)cc1)OCN1CCOCC1 |
| InChI | InChI=1S/C17H26NO6P/c1-3-22-25(20,24-14-18-9-12-21-13-10-18)23-11-8-16-4-6-17(7-5-16)15(2)19/h4-7H,3,8-14H2,1-2H3 |
| InChIKey | KUGGPCZCHACTBI-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.37 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-acetylphenyl)ethyl ethyl morpholin-4-ylmethyl phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-acetylphenyl)ethyl ethyl morpholin-4-ylmethyl phosphate?
The IUPAC name of 2-(4-acetylphenyl)ethyl ethyl morpholin-4-ylmethyl phosphate (CID 139470564) is 2-(4-acetylphenyl)ethyl ethyl morpholin-4-ylmethyl phosphate.
What is the SMILES notation for 2-(4-acetylphenyl)ethyl ethyl morpholin-4-ylmethyl phosphate?
The canonical SMILES for 2-(4-acetylphenyl)ethyl ethyl morpholin-4-ylmethyl phosphate is CCOP(=O)(OCCc1ccc(C(C)=O)cc1)OCN1CCOCC1.
What is the InChIKey of 2-(4-acetylphenyl)ethyl ethyl morpholin-4-ylmethyl phosphate?
The InChIKey is KUGGPCZCHACTBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H26NO6P/c1-3-22-25(20,24-14-18-9-12-21-13-10-18)23-11-8-16-4-6-17(7-5-16)15(2)19/h4-7H,3,8-14H2,1-2H3.
What are the key properties of 2-(4-acetylphenyl)ethyl ethyl morpholin-4-ylmethyl phosphate?
2-(4-acetylphenyl)ethyl ethyl morpholin-4-ylmethyl phosphate has a molecular weight of 371.37 g/mol, XLogP of 2.90, 10 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-acetylphenyl)ethyl ethyl morpholin-4-ylmethyl phosphate is sourced from PubChem (CID 139470564), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).