C22H38NO8P — CID 59290014
4-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy-[2-(4-methylphenyl)ethoxy]phosphoryl]morpholine (PubChem CID 59290014) has the molecular formula C22H38NO8P and a molecular weight of 475.52 g/mol. Its IUPAC name is 4-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy-[2-(4-methylphenyl)ethoxy]phosphoryl]morpholine.
| Compound Name | 4-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy-[2-(4-methylphenyl)ethoxy]phosphoryl]morpholine |
|---|---|
| PubChem CID | 59290014 |
| Molecular Formula | C22H38NO8P |
| Molecular Weight | 475.52 g/mol |
| Exact Mass | 475.23 |
| IUPAC Name | 4-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy-[2-(4-methylphenyl)ethoxy]phosphoryl]morpholine |
| SMILES | COCCOCCOCCOCCOP(=O)(OCCc1ccc(C)cc1)N1CCOCC1 |
| InChI | InChI=1S/C22H38NO8P/c1-21-3-5-22(6-4-21)7-10-30-32(24,23-8-11-26-12-9-23)31-20-19-29-18-17-28-16-15-27-14-13-25-2/h3-6H,7-20H2,1-2H3 |
| InChIKey | CKBHJDHEAIIALZ-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 84.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.52 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|