C30H48N6O6P2 — CID 139064039
N-dimorpholin-4-ylphosphoryl-4-methylaniline (PubChem CID 139064039) has the molecular formula C30H48N6O6P2 and a molecular weight of 650.70 g/mol. Its IUPAC name is N-dimorpholin-4-ylphosphoryl-4-methylaniline.
| Compound Name | N-dimorpholin-4-ylphosphoryl-4-methylaniline |
|---|---|
| PubChem CID | 139064039 |
| Molecular Formula | C30H48N6O6P2 |
| Molecular Weight | 650.70 g/mol |
| Exact Mass | 650.31 |
| IUPAC Name | N-dimorpholin-4-ylphosphoryl-4-methylaniline |
| SMILES | Cc1ccc(NP(=O)(N2CCOCC2)N2CCOCC2)cc1.Cc1ccc(NP(=O)(N2CCOCC2)N2CCOCC2)cc1 |
| InChI | InChI=1S/2C15H24N3O3P/c2*1-14-2-4-15(5-3-14)16-22(19,17-6-10-20-11-7-17)18-8-12-21-13-9-18/h2*2-5H,6-13H2,1H3,(H,16,19) |
| InChIKey | ZHKBOFJCARHYLN-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 108.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.70 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|