C15H23N4O3P — CID 13381631
4-[[(2E)-2-benzylidenehydrazinyl]-morpholin-4-ylphosphoryl]morpholine (PubChem CID 13381631) has the molecular formula C15H23N4O3P and a molecular weight of 338.35 g/mol. Its IUPAC name is 4-[[(2E)-2-benzylidenehydrazinyl]-morpholin-4-ylphosphoryl]morpholine.
| Compound Name | 4-[[(2E)-2-benzylidenehydrazinyl]-morpholin-4-ylphosphoryl]morpholine |
|---|---|
| PubChem CID | 13381631 |
| Molecular Formula | C15H23N4O3P |
| Molecular Weight | 338.35 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | 4-[[(2E)-2-benzylidenehydrazinyl]-morpholin-4-ylphosphoryl]morpholine |
| SMILES | O=P(N/N=C/c1ccccc1)(N1CCOCC1)N1CCOCC1 |
| InChI | InChI=1S/C15H23N4O3P/c20-23(18-6-10-21-11-7-18,19-8-12-22-13-9-19)17-16-14-15-4-2-1-3-5-15/h1-5,14H,6-13H2,(H,17,20)/b16-14+ |
| InChIKey | NQYASWWXJWOKPR-JQIJEIRASA-N |
| XLogP | 1.38 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.35 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|