C14H23N4O2P — CID 13381625
N-methyl-N-[morpholin-4-yl-[(2E)-2-(1-phenylethylidene)hydrazinyl]phosphoryl]methanamine (PubChem CID 13381625) has the molecular formula C14H23N4O2P and a molecular weight of 310.34 g/mol. Its IUPAC name is N-methyl-N-[morpholin-4-yl-[(2E)-2-(1-phenylethylidene)hydrazinyl]phosphoryl]methanamine.
| Compound Name | N-methyl-N-[morpholin-4-yl-[(2E)-2-(1-phenylethylidene)hydrazinyl]phosphoryl]methanamine |
|---|---|
| PubChem CID | 13381625 |
| Molecular Formula | C14H23N4O2P |
| Molecular Weight | 310.34 g/mol |
| Exact Mass | 310.16 |
| IUPAC Name | N-methyl-N-[morpholin-4-yl-[(2E)-2-(1-phenylethylidene)hydrazinyl]phosphoryl]methanamine |
| SMILES | C/C(=N\NP(=O)(N(C)C)N1CCOCC1)c1ccccc1 |
| InChI | InChI=1S/C14H23N4O2P/c1-13(14-7-5-4-6-8-14)15-16-21(19,17(2)3)18-9-11-20-12-10-18/h4-8H,9-12H2,1-3H3,(H,16,19)/b15-13+ |
| InChIKey | ONGLBKCHUMANOX-FYWRMAATSA-N |
| XLogP | 2.00 |
| TPSA | 57.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.34 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|