C24H29N3OP2S — CID 13381643
N-methyl-N-[morpholin-4-yl-[(triphenyl-lambda5-phosphanylidene)amino]phosphinothioyl]methanamine (PubChem CID 13381643) has the molecular formula C24H29N3OP2S and a molecular weight of 469.53 g/mol. Its IUPAC name is N-methyl-N-[morpholin-4-yl-[(triphenyl-lambda5-phosphanylidene)amino]phosphinothioyl]methanamine.
| Compound Name | N-methyl-N-[morpholin-4-yl-[(triphenyl-lambda5-phosphanylidene)amino]phosphinothioyl]methanamine |
|---|---|
| PubChem CID | 13381643 |
| Molecular Formula | C24H29N3OP2S |
| Molecular Weight | 469.53 g/mol |
| Exact Mass | 469.15 |
| IUPAC Name | N-methyl-N-[morpholin-4-yl-[(triphenyl-lambda5-phosphanylidene)amino]phosphinothioyl]methanamine |
| SMILES | CN(C)P(=S)(N=P(c1ccccc1)(c1ccccc1)c1ccccc1)N1CCOCC1 |
| InChI | InChI=1S/C24H29N3OP2S/c1-26(2)30(31,27-18-20-28-21-19-27)25-29(22-12-6-3-7-13-22,23-14-8-4-9-15-23)24-16-10-5-11-17-24/h3-17H,18-21H2,1-2H3 |
| InChIKey | ATPBYDFGVKHBID-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 28.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.53 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|