C18H27N2OPS — CID 2348885
N-methyl-N-[(2-morpholin-4-ylcyclohexen-1-yl)-phenylphosphinothioyl]methanamine (PubChem CID 2348885) has the molecular formula C18H27N2OPS and a molecular weight of 350.47 g/mol. Its IUPAC name is N-methyl-N-[(2-morpholin-4-ylcyclohexen-1-yl)-phenylphosphinothioyl]methanamine.
| Compound Name | N-methyl-N-[(2-morpholin-4-ylcyclohexen-1-yl)-phenylphosphinothioyl]methanamine |
|---|---|
| PubChem CID | 2348885 |
| Molecular Formula | C18H27N2OPS |
| Molecular Weight | 350.47 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | N-methyl-N-[(2-morpholin-4-ylcyclohexen-1-yl)-phenylphosphinothioyl]methanamine |
| SMILES | CN(C)P(=S)(C1=C(N2CCOCC2)CCCC1)c1ccccc1 |
| InChI | InChI=1S/C18H27N2OPS/c1-19(2)22(23,16-8-4-3-5-9-16)18-11-7-6-10-17(18)20-12-14-21-15-13-20/h3-5,8-9H,6-7,10-15H2,1-2H3 |
| InChIKey | VVXMBRVFZMFNHW-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.47 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|